C20H30O2 — CID 10357585
(1R,3aR,5Z,9Z,12aR)-3a,6,10-trimethyl-1-propan-2-yl-3,7,8,11,12,12a-hexahydro-1H-cyclopenta[11]annulene-2,4-dione (PubChem CID 10357585) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,3aR,5Z,9Z,12aR)-3a,6,10-trimethyl-1-propan-2-yl-3,7,8,11,12,12a-hexahydro-1H-cyclopenta[11]annulene-2,4-dione.
| Compound Name | (1R,3aR,5Z,9Z,12aR)-3a,6,10-trimethyl-1-propan-2-yl-3,7,8,11,12,12a-hexahydro-1H-cyclopenta[11]annulene-2,4-dione |
|---|---|
| PubChem CID | 10357585 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,3aR,5Z,9Z,12aR)-3a,6,10-trimethyl-1-propan-2-yl-3,7,8,11,12,12a-hexahydro-1H-cyclopenta[11]annulene-2,4-dione |
| SMILES | C/C1=C/C(=O)[C@]2(C)CC(=O)[C@H](C(C)C)[C@H]2CC/C(C)=C\CC1 |
| InChI | InChI=1S/C20H30O2/c1-13(2)19-16-10-9-14(3)7-6-8-15(4)11-18(22)20(16,5)12-17(19)21/h7,11,13,16,19H,6,8-10,12H2,1-5H3/b14-7-,15-11-/t16-,19-,20-/m1/s1 |
| InChIKey | KPAMHMMBEADFDP-PTVTUDBTSA-N |
| XLogP | 4.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|