C9H19N3O — CID 103576202
3-amino-4-methyl-N-propan-2-ylpyrrolidine-1-carboxamide (PubChem CID 103576202) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-amino-4-methyl-N-propan-2-ylpyrrolidine-1-carboxamide.
| Compound Name | 3-amino-4-methyl-N-propan-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 103576202 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 3-amino-4-methyl-N-propan-2-ylpyrrolidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CC(C)C(N)C1 |
| InChI | InChI=1S/C9H19N3O/c1-6(2)11-9(13)12-4-7(3)8(10)5-12/h6-8H,4-5,10H2,1-3H3,(H,11,13) |
| InChIKey | UNIIEDQPBMVUIL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |