C10H18N4O2 — CID 103576544
3-[2-(3-amino-4-methylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 103576544) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-[2-(3-amino-4-methylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-(3-amino-4-methylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103576544 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 3-[2-(3-amino-4-methylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | CC1CN(CCN2C(=O)CNC2=O)CC1N |
| InChI | InChI=1S/C10H18N4O2/c1-7-5-13(6-8(7)11)2-3-14-9(15)4-12-10(14)16/h7-8H,2-6,11H2,1H3,(H,12,16) |
| InChIKey | MAUZYLDAVWIAIE-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|