C8H8F4N2O4S2 — CID 103577897
methyl 5-(2,2,3,3-tetrafluoropropylsulfamoyl)-1,3-thiazole-4-carboxylate (PubChem CID 103577897) has the molecular formula C8H8F4N2O4S2 and a molecular weight of 336.29 g/mol. Its IUPAC name is methyl 5-(2,2,3,3-tetrafluoropropylsulfamoyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 5-(2,2,3,3-tetrafluoropropylsulfamoyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103577897 |
| Molecular Formula | C8H8F4N2O4S2 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | methyl 5-(2,2,3,3-tetrafluoropropylsulfamoyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H8F4N2O4S2/c1-18-5(15)4-6(19-3-13-4)20(16,17)14-2-8(11,12)7(9)10/h3,7,14H,2H2,1H3 |
| InChIKey | ASMQEWWRFNEICC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|