C9H11F4N3O4S — CID 103577926
ethyl 5-(2,2,3,3-tetrafluoropropylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 103577926) has the molecular formula C9H11F4N3O4S and a molecular weight of 333.26 g/mol. Its IUPAC name is ethyl 5-(2,2,3,3-tetrafluoropropylsulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(2,2,3,3-tetrafluoropropylsulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 103577926 |
| Molecular Formula | C9H11F4N3O4S |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | ethyl 5-(2,2,3,3-tetrafluoropropylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H11F4N3O4S/c1-2-20-7(17)5-3-14-16-6(5)21(18,19)15-4-9(12,13)8(10)11/h3,8,15H,2,4H2,1H3,(H,14,16) |
| InChIKey | OWIOJSXWZORUSE-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|