C18H26O4 — CID 10357814
(1S,5R,9R,12S)-3,3,12-trimethylspiro[2,4,11-trioxatetracyclo[7.5.2.01,5.012,16]hexadecane-15,1'-cyclopropane]-10-one (PubChem CID 10357814) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (1S,5R,9R,12S)-3,3,12-trimethylspiro[2,4,11-trioxatetracyclo[7.5.2.01,5.012,16]hexadecane-15,1'-cyclopropane]-10-one.
| Compound Name | (1S,5R,9R,12S)-3,3,12-trimethylspiro[2,4,11-trioxatetracyclo[7.5.2.01,5.012,16]hexadecane-15,1'-cyclopropane]-10-one |
|---|---|
| PubChem CID | 10357814 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (1S,5R,9R,12S)-3,3,12-trimethylspiro[2,4,11-trioxatetracyclo[7.5.2.01,5.012,16]hexadecane-15,1'-cyclopropane]-10-one |
| SMILES | CC1(C)O[C@@H]2CCC[C@H]3C(=O)O[C@@]4(C)CC[C@]2(O1)C1(CC1)C34 |
| InChI | InChI=1S/C18H26O4/c1-15(2)20-12-6-4-5-11-13-16(3,21-14(11)19)7-10-18(12,22-15)17(13)8-9-17/h11-13H,4-10H2,1-3H3/t11-,12-,13?,16+,18-/m1/s1 |
| InChIKey | YBEUISURDNIPQS-CEUWZNLSSA-N |
| XLogP | 3.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |