C12H23F2NO — CID 103578391
2-[2,2-difluoroethyl-(4-ethylcyclohexyl)amino]ethanol (PubChem CID 103578391) has the molecular formula C12H23F2NO and a molecular weight of 235.32 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-(4-ethylcyclohexyl)amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-(4-ethylcyclohexyl)amino]ethanol |
|---|---|
| PubChem CID | 103578391 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-[2,2-difluoroethyl-(4-ethylcyclohexyl)amino]ethanol |
| SMILES | CCC1CCC(N(CCO)CC(F)F)CC1 |
| InChI | InChI=1S/C12H23F2NO/c1-2-10-3-5-11(6-4-10)15(7-8-16)9-12(13)14/h10-12,16H,2-9H2,1H3 |
| InChIKey | IHTPDSSRJOMTKW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |