About (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one
(2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one (PubChem CID 10357947) has the molecular formula C19H32O3
and a molecular weight of 308.46 g/mol. Its IUPAC name is (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one |
| PubChem CID | 10357947 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one |
| SMILES | CCCCCCCCCCCC(=O)C1=C(C)C[C@H](C)OC1=O |
| InChI | InChI=1S/C19H32O3/c1-4-5-6-7-8-9-10-11-12-13-17(20)18-15(2)14-16(3)22-19(18)21/h16H,4-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | IBSUGPKFCLTAFW-INIZCTEOSA-N |
| XLogP | 5.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one?
The IUPAC name of (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one (CID 10357947) is (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one.
What is the SMILES notation for (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one?
The canonical SMILES for (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one is CCCCCCCCCCCC(=O)C1=C(C)C[C@H](C)OC1=O.
What is the InChIKey of (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one?
The InChIKey is IBSUGPKFCLTAFW-INIZCTEOSA-N. The full InChI is InChI=1S/C19H32O3/c1-4-5-6-7-8-9-10-11-12-13-17(20)18-15(2)14-16(3)22-19(18)21/h16H,4-14H2,1-3H3/t16-/m0/s1.
What are the key properties of (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one?
(2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one has a molecular weight of 308.46 g/mol, XLogP of 5.13, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-dodecanoyl-2,4-dimethyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 10357947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).