C12H13FN2O3S — CID 103579485
2-fluoro-N-pent-1-yn-3-yl-4-sulfamoylbenzamide (PubChem CID 103579485) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-fluoro-N-pent-1-yn-3-yl-4-sulfamoylbenzamide.
| Compound Name | 2-fluoro-N-pent-1-yn-3-yl-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 103579485 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-fluoro-N-pent-1-yn-3-yl-4-sulfamoylbenzamide |
| SMILES | C#CC(CC)NC(=O)c1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C12H13FN2O3S/c1-3-8(4-2)15-12(16)10-6-5-9(7-11(10)13)19(14,17)18/h1,5-8H,4H2,2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | GKSXSVHGRMKBFS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|