C15H19NO6 — CID 10357967
3-(6-hydroxy-2,7,8-trimethyl-5-nitro-3,4-dihydrochromen-2-yl)propanoic acid (PubChem CID 10357967) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-(6-hydroxy-2,7,8-trimethyl-5-nitro-3,4-dihydrochromen-2-yl)propanoic acid.
| Compound Name | 3-(6-hydroxy-2,7,8-trimethyl-5-nitro-3,4-dihydrochromen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 10357967 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-(6-hydroxy-2,7,8-trimethyl-5-nitro-3,4-dihydrochromen-2-yl)propanoic acid |
| SMILES | Cc1c(C)c2c(c([N+](=O)[O-])c1O)CCC(C)(CCC(=O)O)O2 |
| InChI | InChI=1S/C15H19NO6/c1-8-9(2)14-10(12(13(8)19)16(20)21)4-6-15(3,22-14)7-5-11(17)18/h19H,4-7H2,1-3H3,(H,17,18) |
| InChIKey | CWNURYDWCCNADI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|