C12H24O5P2 — CID 10358012
[(3E)-1-[hydroxy(methyl)phosphoryl]-4,8-dimethylnona-3,7-dienyl]phosphonic acid (PubChem CID 10358012) has the molecular formula C12H24O5P2 and a molecular weight of 310.27 g/mol. Its IUPAC name is [(3E)-1-[hydroxy(methyl)phosphoryl]-4,8-dimethylnona-3,7-dienyl]phosphonic acid.
| Compound Name | [(3E)-1-[hydroxy(methyl)phosphoryl]-4,8-dimethylnona-3,7-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10358012 |
| Molecular Formula | C12H24O5P2 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [(3E)-1-[hydroxy(methyl)phosphoryl]-4,8-dimethylnona-3,7-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC(P(C)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H24O5P2/c1-10(2)6-5-7-11(3)8-9-12(18(4,13)14)19(15,16)17/h6,8,12H,5,7,9H2,1-4H3,(H,13,14)(H2,15,16,17)/b11-8+ |
| InChIKey | CANRJQVKVMBKHH-DHZHZOJOSA-N |
| XLogP | 3.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|