C13H17ClN2O — CID 103580798
N-[(3-chloro-4-pyridinyl)methyl]-2-cyclopropyloxolan-3-amine (PubChem CID 103580798) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is N-[(3-chloro-4-pyridinyl)methyl]-2-cyclopropyloxolan-3-amine.
| Compound Name | N-[(3-chloro-4-pyridinyl)methyl]-2-cyclopropyloxolan-3-amine |
|---|---|
| PubChem CID | 103580798 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-[(3-chloro-4-pyridinyl)methyl]-2-cyclopropyloxolan-3-amine |
| SMILES | Clc1cnccc1CNC1CCOC1C1CC1 |
| InChI | InChI=1S/C13H17ClN2O/c14-11-8-15-5-3-10(11)7-16-12-4-6-17-13(12)9-1-2-9/h3,5,8-9,12-13,16H,1-2,4,6-7H2 |
| InChIKey | BRLNANLMNCXNPR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |