About N-ethyl-2,3-dimethyloxolan-3-amine
N-ethyl-2,3-dimethyloxolan-3-amine (PubChem CID 103581198) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is N-ethyl-2,3-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-ethyl-2,3-dimethyloxolan-3-amine |
| PubChem CID | 103581198 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N-ethyl-2,3-dimethyloxolan-3-amine |
| SMILES | CCNC1(C)CCOC1C |
| InChI | InChI=1S/C8H17NO/c1-4-9-8(3)5-6-10-7(8)2/h7,9H,4-6H2,1-3H3 |
| InChIKey | GCFWYMOSERJKDP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2,3-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3-dimethyloxolan-3-amine?
The IUPAC name of N-ethyl-2,3-dimethyloxolan-3-amine (CID 103581198) is N-ethyl-2,3-dimethyloxolan-3-amine.
What is the SMILES notation for N-ethyl-2,3-dimethyloxolan-3-amine?
The canonical SMILES for N-ethyl-2,3-dimethyloxolan-3-amine is CCNC1(C)CCOC1C.
What is the InChIKey of N-ethyl-2,3-dimethyloxolan-3-amine?
The InChIKey is GCFWYMOSERJKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-4-9-8(3)5-6-10-7(8)2/h7,9H,4-6H2,1-3H3.
What are the key properties of N-ethyl-2,3-dimethyloxolan-3-amine?
N-ethyl-2,3-dimethyloxolan-3-amine has a molecular weight of 143.23 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3-dimethyloxolan-3-amine is sourced from PubChem (CID 103581198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).