About 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide
2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide (PubChem CID 103581324) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide |
| PubChem CID | 103581324 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)NC1(C)CCOC1C |
| InChI | InChI=1S/C13H26N2O2/c1-6-15(7-2)12(16)10(3)14-13(5)8-9-17-11(13)4/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | MMQZNUCTABPPQR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide?
The IUPAC name of 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide (CID 103581324) is 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide.
What is the SMILES notation for 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide?
The canonical SMILES for 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide is CCN(CC)C(=O)C(C)NC1(C)CCOC1C.
What is the InChIKey of 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide?
The InChIKey is MMQZNUCTABPPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-6-15(7-2)12(16)10(3)14-13(5)8-9-17-11(13)4/h10-11,14H,6-9H2,1-5H3.
What are the key properties of 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide?
2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide has a molecular weight of 242.36 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethyloxolan-3-yl)amino]-N,N-diethylpropanamide is sourced from PubChem (CID 103581324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).