C13H16BrClN2O — CID 103581539
2-[(4-bromo-3-chlorophenyl)methylamino]-1-pyrrolidin-1-ylethanone (PubChem CID 103581539) has the molecular formula C13H16BrClN2O and a molecular weight of 331.64 g/mol. Its IUPAC name is 2-[(4-bromo-3-chlorophenyl)methylamino]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[(4-bromo-3-chlorophenyl)methylamino]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 103581539 |
| Molecular Formula | C13H16BrClN2O |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2-[(4-bromo-3-chlorophenyl)methylamino]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CNCc1ccc(Br)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C13H16BrClN2O/c14-11-4-3-10(7-12(11)15)8-16-9-13(18)17-5-1-2-6-17/h3-4,7,16H,1-2,5-6,8-9H2 |
| InChIKey | BMTORWNYSWVWRD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |