About 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine
1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine (PubChem CID 103581787) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine |
| PubChem CID | 103581787 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine |
| SMILES | COCC(C)NCCc1ncno1 |
| InChI | InChI=1S/C8H15N3O2/c1-7(5-12-2)9-4-3-8-10-6-11-13-8/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | QTXAJOLMAOKJPM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine?
The IUPAC name of 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine (CID 103581787) is 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine.
What is the SMILES notation for 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine?
The canonical SMILES for 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine is COCC(C)NCCc1ncno1.
What is the InChIKey of 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine?
The InChIKey is QTXAJOLMAOKJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-7(5-12-2)9-4-3-8-10-6-11-13-8/h6-7,9H,3-5H2,1-2H3.
What are the key properties of 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine?
1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine has a molecular weight of 185.23 g/mol, XLogP of 0.24, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-N-[2-(1,2,4-oxadiazol-5-yl)ethyl]propan-2-amine is sourced from PubChem (CID 103581787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).