C13H12BrClN2 — CID 103583097
5-bromo-3-chloro-N-(3,5-dimethylphenyl)pyridin-2-amine (PubChem CID 103583097) has the molecular formula C13H12BrClN2 and a molecular weight of 311.61 g/mol. Its IUPAC name is 5-bromo-3-chloro-N-(3,5-dimethylphenyl)pyridin-2-amine.
| Compound Name | 5-bromo-3-chloro-N-(3,5-dimethylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103583097 |
| Molecular Formula | C13H12BrClN2 |
| Molecular Weight | 311.61 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 5-bromo-3-chloro-N-(3,5-dimethylphenyl)pyridin-2-amine |
| SMILES | Cc1cc(C)cc(Nc2ncc(Br)cc2Cl)c1 |
| InChI | InChI=1S/C13H12BrClN2/c1-8-3-9(2)5-11(4-8)17-13-12(15)6-10(14)7-16-13/h3-7H,1-2H3,(H,16,17) |
| InChIKey | AZQFBYBBRIMBAV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |