C18H29N5 — CID 10358346
1-(4-heptylphenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 10358346) has the molecular formula C18H29N5 and a molecular weight of 315.47 g/mol. Its IUPAC name is 1-(4-heptylphenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 1-(4-heptylphenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 10358346 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-(4-heptylphenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCCc1ccc(N2C(N)=NC(N)=NC2(C)C)cc1 |
| InChI | InChI=1S/C18H29N5/c1-4-5-6-7-8-9-14-10-12-15(13-11-14)23-17(20)21-16(19)22-18(23,2)3/h10-13H,4-9H2,1-3H3,(H4,19,20,21,22) |
| InChIKey | SHKQYLGCCJGWKG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|