About 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline
2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline (PubChem CID 10358364) has the molecular formula C14H12F4N2O2
and a molecular weight of 316.25 g/mol. Its IUPAC name is 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline.
Molecular Properties
| Compound Name | 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline |
| PubChem CID | 10358364 |
| Molecular Formula | C14H12F4N2O2 |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline |
| SMILES | Nc1ccc(F)c(F)c1OCCOc1c(N)ccc(F)c1F |
| InChI | InChI=1S/C14H12F4N2O2/c15-7-1-3-9(19)13(11(7)17)21-5-6-22-14-10(20)4-2-8(16)12(14)18/h1-4H,5-6,19-20H2 |
| InChIKey | AIXFFPGCEOZYJI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline?
The IUPAC name of 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline (CID 10358364) is 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline.
What is the SMILES notation for 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline?
The canonical SMILES for 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline is Nc1ccc(F)c(F)c1OCCOc1c(N)ccc(F)c1F.
What is the InChIKey of 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline?
The InChIKey is AIXFFPGCEOZYJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F4N2O2/c15-7-1-3-9(19)13(11(7)17)21-5-6-22-14-10(20)4-2-8(16)12(14)18/h1-4H,5-6,19-20H2.
What are the key properties of 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline?
2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline has a molecular weight of 316.25 g/mol, XLogP of 2.87, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(6-amino-2,3-difluorophenoxy)ethoxy]-3,4-difluoroaniline is sourced from PubChem (CID 10358364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).