C16H16BrF2NO — CID 103584719
4-bromo-2-[1-(2,5-difluoro-4-methylanilino)propyl]phenol (PubChem CID 103584719) has the molecular formula C16H16BrF2NO and a molecular weight of 356.21 g/mol. Its IUPAC name is 4-bromo-2-[1-(2,5-difluoro-4-methylanilino)propyl]phenol.
| Compound Name | 4-bromo-2-[1-(2,5-difluoro-4-methylanilino)propyl]phenol |
|---|---|
| PubChem CID | 103584719 |
| Molecular Formula | C16H16BrF2NO |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-bromo-2-[1-(2,5-difluoro-4-methylanilino)propyl]phenol |
| SMILES | CCC(Nc1cc(F)c(C)cc1F)c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H16BrF2NO/c1-3-14(11-7-10(17)4-5-16(11)21)20-15-8-12(18)9(2)6-13(15)19/h4-8,14,20-21H,3H2,1-2H3 |
| InChIKey | IGGNKSJOUGTTRX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|