C10H11F2N — CID 103585426
5,8-difluoro-6-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 103585426) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is 5,8-difluoro-6-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5,8-difluoro-6-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 103585426 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5,8-difluoro-6-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1cc(F)c2c(c1F)CCCN2 |
| InChI | InChI=1S/C10H11F2N/c1-6-5-8(11)10-7(9(6)12)3-2-4-13-10/h5,13H,2-4H2,1H3 |
| InChIKey | MLTYRFFMROBYLT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |