C12H9F3N2O2S — CID 103585478
N-(2,5-difluoro-4-methylphenyl)-3-fluoropyridine-2-sulfonamide (PubChem CID 103585478) has the molecular formula C12H9F3N2O2S and a molecular weight of 302.28 g/mol. Its IUPAC name is N-(2,5-difluoro-4-methylphenyl)-3-fluoropyridine-2-sulfonamide.
| Compound Name | N-(2,5-difluoro-4-methylphenyl)-3-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 103585478 |
| Molecular Formula | C12H9F3N2O2S |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | N-(2,5-difluoro-4-methylphenyl)-3-fluoropyridine-2-sulfonamide |
| SMILES | Cc1cc(F)c(NS(=O)(=O)c2ncccc2F)cc1F |
| InChI | InChI=1S/C12H9F3N2O2S/c1-7-5-10(15)11(6-9(7)14)17-20(18,19)12-8(13)3-2-4-16-12/h2-6,17H,1H3 |
| InChIKey | CCTRBZVWVRFNDB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |