About 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine
2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine (PubChem CID 10358578) has the molecular formula C17H13N5S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine |
| PubChem CID | 10358578 |
| Molecular Formula | C17H13N5S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine |
| SMILES | Cc1csc(-c2nc(Nc3ccncc3)c3ccccc3n2)n1 |
| InChI | InChI=1S/C17H13N5S/c1-11-10-23-17(19-11)16-21-14-5-3-2-4-13(14)15(22-16)20-12-6-8-18-9-7-12/h2-10H,1H3,(H,18,20,21,22) |
| InChIKey | NBMFKJACAZPWPF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine?
The IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine (CID 10358578) is 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine is Cc1csc(-c2nc(Nc3ccncc3)c3ccccc3n2)n1.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine?
The InChIKey is NBMFKJACAZPWPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5S/c1-11-10-23-17(19-11)16-21-14-5-3-2-4-13(14)15(22-16)20-12-6-8-18-9-7-12/h2-10H,1H3,(H,18,20,21,22).
What are the key properties of 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine?
2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine has a molecular weight of 319.39 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-2-yl)-N-pyridin-4-ylquinazolin-4-amine is sourced from PubChem (CID 10358578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).