C18H11NO5 — CID 10358682
11-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,12,14,16,18-heptaene-9,10-dione (PubChem CID 10358682) has the molecular formula C18H11NO5 and a molecular weight of 321.29 g/mol. Its IUPAC name is 11-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,12,14,16,18-heptaene-9,10-dione.
| Compound Name | 11-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,12,14,16,18-heptaene-9,10-dione |
|---|---|
| PubChem CID | 10358682 |
| Molecular Formula | C18H11NO5 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 11-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,12,14,16,18-heptaene-9,10-dione |
| SMILES | CON1C(=O)C(=O)c2cc3c(c4c2c1cc1ccccc14)OCO3 |
| InChI | InChI=1S/C18H11NO5/c1-22-19-12-6-9-4-2-3-5-10(9)15-14(12)11(16(20)18(19)21)7-13-17(15)24-8-23-13/h2-7H,8H2,1H3 |
| InChIKey | XUJFJXWSVDREJO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|