About 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile
4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile (PubChem CID 103587302) has the molecular formula C11H7F2N3
and a molecular weight of 219.19 g/mol. Its IUPAC name is 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile |
| PubChem CID | 103587302 |
| Molecular Formula | C11H7F2N3 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile |
| SMILES | Cc1cc(F)c2ncc(C#N)c(N)c2c1F |
| InChI | InChI=1S/C11H7F2N3/c1-5-2-7(12)11-8(9(5)13)10(15)6(3-14)4-16-11/h2,4H,1H3,(H2,15,16) |
| InChIKey | XZXMZUIETNJGSK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile?
The IUPAC name of 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile (CID 103587302) is 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile.
What is the SMILES notation for 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile?
The canonical SMILES for 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile is Cc1cc(F)c2ncc(C#N)c(N)c2c1F.
What is the InChIKey of 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile?
The InChIKey is XZXMZUIETNJGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F2N3/c1-5-2-7(12)11-8(9(5)13)10(15)6(3-14)4-16-11/h2,4H,1H3,(H2,15,16).
What are the key properties of 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile?
4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile has a molecular weight of 219.19 g/mol, XLogP of 2.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile is sourced from PubChem (CID 103587302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).