C11H7F2N3 — CID 103587302
4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile (PubChem CID 103587302) has the molecular formula C11H7F2N3 and a molecular weight of 219.19 g/mol. Its IUPAC name is 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile.
| Compound Name | 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 103587302 |
| Molecular Formula | C11H7F2N3 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-amino-5,8-difluoro-6-methylquinoline-3-carbonitrile |
| SMILES | Cc1cc(F)c2ncc(C#N)c(N)c2c1F |
| InChI | InChI=1S/C11H7F2N3/c1-5-2-7(12)11-8(9(5)13)10(15)6(3-14)4-16-11/h2,4H,1H3,(H2,15,16) |
| InChIKey | XZXMZUIETNJGSK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |