About CID 10358846
CID 10358846 (PubChem CID 10358846) has the molecular formula C18H19N4S
and a molecular weight of 323.44 g/mol.
Molecular Properties
| Compound Name | CID 10358846 |
| PubChem CID | 10358846 |
| Molecular Formula | C18H19N4S |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=NN(c2ccccc2)C(=S)N(c2ccccc2)[N]1 |
| InChI | InChI=1S/C18H19N4S/c1-18(2,3)16-19-21(14-10-6-4-7-11-14)17(23)22(20-16)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChIKey | XNHWEJQQZOWVQM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 10358846 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10358846?
The IUPAC name of CID 10358846 (CID 10358846) is not available.
What is the SMILES notation for CID 10358846?
The canonical SMILES for CID 10358846 is CC(C)(C)C1=NN(c2ccccc2)C(=S)N(c2ccccc2)[N]1.
What is the InChIKey of CID 10358846?
The InChIKey is XNHWEJQQZOWVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N4S/c1-18(2,3)16-19-21(14-10-6-4-7-11-14)17(23)22(20-16)15-12-8-5-9-13-15/h4-13H,1-3H3.
What are the key properties of CID 10358846?
CID 10358846 has a molecular weight of 323.44 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10358846 is sourced from PubChem (CID 10358846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).