C17H25NO3S — CID 10358848
1-[(2S,3R)-1-(benzenesulfonyl)-2-methylpentan-3-yl]piperidin-4-one (PubChem CID 10358848) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-[(2S,3R)-1-(benzenesulfonyl)-2-methylpentan-3-yl]piperidin-4-one.
| Compound Name | 1-[(2S,3R)-1-(benzenesulfonyl)-2-methylpentan-3-yl]piperidin-4-one |
|---|---|
| PubChem CID | 10358848 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[(2S,3R)-1-(benzenesulfonyl)-2-methylpentan-3-yl]piperidin-4-one |
| SMILES | CC[C@H]([C@H](C)CS(=O)(=O)c1ccccc1)N1CCC(=O)CC1 |
| InChI | InChI=1S/C17H25NO3S/c1-3-17(18-11-9-15(19)10-12-18)14(2)13-22(20,21)16-7-5-4-6-8-16/h4-8,14,17H,3,9-13H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | SLCMOEXOGATRID-RHSMWYFYSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |