C19H18NO4+ — CID 10358881
3,9-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,10-diol (PubChem CID 10358881) has the molecular formula C19H18NO4+ and a molecular weight of 324.36 g/mol. Its IUPAC name is 3,9-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,10-diol.
| Compound Name | 3,9-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,10-diol |
|---|---|
| PubChem CID | 10358881 |
| Molecular Formula | C19H18NO4+ |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3,9-dimethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium-2,10-diol |
| SMILES | COc1cc2c(cc1O)-c1cc3ccc(O)c(OC)c3c[n+]1CC2 |
| InChI | InChI=1S/C19H17NO4/c1-23-18-8-12-5-6-20-10-14-11(3-4-16(21)19(14)24-2)7-15(20)13(12)9-17(18)22/h3-4,7-10H,5-6H2,1-2H3,(H-,21,22)/p+1 |
| InChIKey | BENXORZPKXUGMY-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|