About [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate
[(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate (PubChem CID 10358889) has the molecular formula C16H20O5S
and a molecular weight of 324.40 g/mol. Its IUPAC name is [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate.
Molecular Properties
| Compound Name | [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate |
| PubChem CID | 10358889 |
| Molecular Formula | C16H20O5S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate |
| SMILES | CC(=O)O[C@H]1CCC(=O)C[C@@H](S(=O)(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C16H20O5S/c1-11-15(21-12(2)17)9-8-13(18)10-16(11)22(19,20)14-6-4-3-5-7-14/h3-7,11,15-16H,8-10H2,1-2H3/t11-,15-,16+/m0/s1 |
| InChIKey | DUVTWHNWDZGPEM-KNXALSJPSA-N |
| XLogP | 2.15 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate?
The IUPAC name of [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate (CID 10358889) is [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate.
What is the SMILES notation for [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate?
The canonical SMILES for [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate is CC(=O)O[C@H]1CCC(=O)C[C@@H](S(=O)(=O)c2ccccc2)[C@H]1C.
What is the InChIKey of [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate?
The InChIKey is DUVTWHNWDZGPEM-KNXALSJPSA-N. The full InChI is InChI=1S/C16H20O5S/c1-11-15(21-12(2)17)9-8-13(18)10-16(11)22(19,20)14-6-4-3-5-7-14/h3-7,11,15-16H,8-10H2,1-2H3/t11-,15-,16+/m0/s1.
What are the key properties of [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate?
[(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate has a molecular weight of 324.40 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S,3R)-3-(benzenesulfonyl)-2-methyl-5-oxocycloheptyl] acetate is sourced from PubChem (CID 10358889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).