C10H7BrClN5O3 — CID 103589659
4-(3-bromo-5-nitrophenoxy)-6-chloro-N-methyl-1,3,5-triazin-2-amine (PubChem CID 103589659) has the molecular formula C10H7BrClN5O3 and a molecular weight of 360.56 g/mol. Its IUPAC name is 4-(3-bromo-5-nitrophenoxy)-6-chloro-N-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-bromo-5-nitrophenoxy)-6-chloro-N-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103589659 |
| Molecular Formula | C10H7BrClN5O3 |
| Molecular Weight | 360.56 g/mol |
| Exact Mass | 358.94 |
| IUPAC Name | 4-(3-bromo-5-nitrophenoxy)-6-chloro-N-methyl-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(Cl)nc(Oc2cc(Br)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C10H7BrClN5O3/c1-13-9-14-8(12)15-10(16-9)20-7-3-5(11)2-6(4-7)17(18)19/h2-4H,1H3,(H,13,14,15,16) |
| InChIKey | MPQOKFRBVDVZKV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|