C19H10N4O2 — CID 10359002
3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 10359002) has the molecular formula C19H10N4O2 and a molecular weight of 326.31 g/mol. Its IUPAC name is 3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 10359002 |
| Molecular Formula | C19H10N4O2 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3ccccc3[nH]c1c1[nH]c3ncccc3c21 |
| InChI | InChI=1S/C19H10N4O2/c24-18-13-11-8-4-1-2-6-10(8)21-15(11)16-12(14(13)19(25)23-18)9-5-3-7-20-17(9)22-16/h1-7,21H,(H,20,22)(H,23,24,25) |
| InChIKey | CGVIDEBVTXXEDX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|