About [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate
[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate (PubChem CID 10359036) has the molecular formula C16H26O5Si
and a molecular weight of 326.47 g/mol. Its IUPAC name is [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate.
Molecular Properties
| Compound Name | [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate |
| PubChem CID | 10359036 |
| Molecular Formula | C16H26O5Si |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate |
| SMILES | C[C@H](CCO[Si](C)(C)C(C)(C)C)OC(=O)c1cccoc1=O |
| InChI | InChI=1S/C16H26O5Si/c1-12(9-11-20-22(5,6)16(2,3)4)21-15(18)13-8-7-10-19-14(13)17/h7-8,10,12H,9,11H2,1-6H3/t12-/m1/s1 |
| InChIKey | IOGZSOJLVKIEHM-GFCCVEGCSA-N |
| XLogP | 3.60 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate?
The IUPAC name of [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate (CID 10359036) is [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate.
What is the SMILES notation for [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate?
The canonical SMILES for [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate is C[C@H](CCO[Si](C)(C)C(C)(C)C)OC(=O)c1cccoc1=O.
What is the InChIKey of [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate?
The InChIKey is IOGZSOJLVKIEHM-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H26O5Si/c1-12(9-11-20-22(5,6)16(2,3)4)21-15(18)13-8-7-10-19-14(13)17/h7-8,10,12H,9,11H2,1-6H3/t12-/m1/s1.
What are the key properties of [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate?
[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate has a molecular weight of 326.47 g/mol, XLogP of 3.60, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] 2-oxopyran-3-carboxylate is sourced from PubChem (CID 10359036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).