C9H10FN3O3 — CID 103591433
2-(4-fluoro-5-methyl-2-nitroanilino)acetamide (PubChem CID 103591433) has the molecular formula C9H10FN3O3 and a molecular weight of 227.19 g/mol. Its IUPAC name is 2-(4-fluoro-5-methyl-2-nitroanilino)acetamide.
| Compound Name | 2-(4-fluoro-5-methyl-2-nitroanilino)acetamide |
|---|---|
| PubChem CID | 103591433 |
| Molecular Formula | C9H10FN3O3 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-(4-fluoro-5-methyl-2-nitroanilino)acetamide |
| SMILES | Cc1cc(NCC(N)=O)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C9H10FN3O3/c1-5-2-7(12-4-9(11)14)8(13(15)16)3-6(5)10/h2-3,12H,4H2,1H3,(H2,11,14) |
| InChIKey | JMGNHZQJEFXCPQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|