C15H19FN2OS — CID 103592442
3-(2,2-dimethyloxan-4-yl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione (PubChem CID 103592442) has the molecular formula C15H19FN2OS and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-(2,2-dimethyloxan-4-yl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(2,2-dimethyloxan-4-yl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103592442 |
| Molecular Formula | C15H19FN2OS |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-(2,2-dimethyloxan-4-yl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C15H19FN2OS/c1-9-6-13-12(7-11(9)16)17-14(20)18(13)10-4-5-19-15(2,3)8-10/h6-7,10H,4-5,8H2,1-3H3,(H,17,20) |
| InChIKey | OWNTYMSYVOHIQN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|