C21H30O3 — CID 10359306
methyl (6E,10Z,14E,15aS)-3,6,14-trimethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-10-carboxylate (PubChem CID 10359306) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is methyl (6E,10Z,14E,15aS)-3,6,14-trimethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-10-carboxylate.
| Compound Name | methyl (6E,10Z,14E,15aS)-3,6,14-trimethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-10-carboxylate |
|---|---|
| PubChem CID | 10359306 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | methyl (6E,10Z,14E,15aS)-3,6,14-trimethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan-10-carboxylate |
| SMILES | COC(=O)/C1=C\CC/C(C)=C/[C@@H]2OCC(C)=C2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C21H30O3/c1-15-7-5-9-18(21(22)23-4)10-6-8-16(2)13-20-19(12-11-15)17(3)14-24-20/h7,10,13,20H,5-6,8-9,11-12,14H2,1-4H3/b15-7+,16-13+,18-10-/t20-/m0/s1 |
| InChIKey | UMWCCWVWWMKNLD-PJYZZHRXSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|