C17H34O4Si — CID 10359315
(1R,4R,5S,6R,7R)-4-(methoxymethoxy)-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-ol (PubChem CID 10359315) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (1R,4R,5S,6R,7R)-4-(methoxymethoxy)-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-ol.
| Compound Name | (1R,4R,5S,6R,7R)-4-(methoxymethoxy)-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-ol |
|---|---|
| PubChem CID | 10359315 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (1R,4R,5S,6R,7R)-4-(methoxymethoxy)-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@H](OCOC)C=C[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C17H34O4Si/c1-7-22(8-2,9-3)21-17-13(4)15(18)10-11-16(14(17)5)20-12-19-6/h10-11,13-18H,7-9,12H2,1-6H3/t13-,14+,15-,16-,17-/m1/s1 |
| InChIKey | PHDGTZFHQXLHJG-ZHCJQAHYSA-N |
| XLogP | 3.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|