C15H19ClFN3 — CID 103593490
2-(2-chloroethyl)-5-fluoro-6-methyl-1-(1-methylpyrrolidin-3-yl)benzimidazole (PubChem CID 103593490) has the molecular formula C15H19ClFN3 and a molecular weight of 295.79 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(1-methylpyrrolidin-3-yl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(1-methylpyrrolidin-3-yl)benzimidazole |
|---|---|
| PubChem CID | 103593490 |
| Molecular Formula | C15H19ClFN3 |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-(2-chloroethyl)-5-fluoro-6-methyl-1-(1-methylpyrrolidin-3-yl)benzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(CCCl)n2C1CCN(C)C1 |
| InChI | InChI=1S/C15H19ClFN3/c1-10-7-14-13(8-12(10)17)18-15(3-5-16)20(14)11-4-6-19(2)9-11/h7-8,11H,3-6,9H2,1-2H3 |
| InChIKey | ZVVGWBKDGLFLAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|