C14H18N4OS — CID 103594731
4-methyl-3-[3-(4-methylthiomorpholin-3-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 103594731) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-methyl-3-[3-(4-methylthiomorpholin-3-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4-methyl-3-[3-(4-methylthiomorpholin-3-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 103594731 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-methyl-3-[3-(4-methylthiomorpholin-3-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Cc1ccc(N)cc1-c1nc(C2CSCCN2C)no1 |
| InChI | InChI=1S/C14H18N4OS/c1-9-3-4-10(15)7-11(9)14-16-13(17-19-14)12-8-20-6-5-18(12)2/h3-4,7,12H,5-6,8,15H2,1-2H3 |
| InChIKey | FRSBNQOWRPRAAA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|