C19H31N3O2 — CID 10359494
8-methoxy-5,5,8-trimethyl-3,6,10-triazabicyclo[12.4.0]octadeca-1(18),14,16-trien-7-one (PubChem CID 10359494) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 8-methoxy-5,5,8-trimethyl-3,6,10-triazabicyclo[12.4.0]octadeca-1(18),14,16-trien-7-one.
| Compound Name | 8-methoxy-5,5,8-trimethyl-3,6,10-triazabicyclo[12.4.0]octadeca-1(18),14,16-trien-7-one |
|---|---|
| PubChem CID | 10359494 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 8-methoxy-5,5,8-trimethyl-3,6,10-triazabicyclo[12.4.0]octadeca-1(18),14,16-trien-7-one |
| SMILES | COC1(C)CNCCCc2ccccc2CNCC(C)(C)NC1=O |
| InChI | InChI=1S/C19H31N3O2/c1-18(2)13-21-12-16-9-6-5-8-15(16)10-7-11-20-14-19(3,24-4)17(23)22-18/h5-6,8-9,20-21H,7,10-14H2,1-4H3,(H,22,23) |
| InChIKey | UYVOZSZADBRPMM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |