C20H23N3O — CID 103597286
6-methoxy-2-(4-methyl-3-piperidin-1-ylphenyl)-1H-benzimidazole (PubChem CID 103597286) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 6-methoxy-2-(4-methyl-3-piperidin-1-ylphenyl)-1H-benzimidazole.
| Compound Name | 6-methoxy-2-(4-methyl-3-piperidin-1-ylphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 103597286 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 6-methoxy-2-(4-methyl-3-piperidin-1-ylphenyl)-1H-benzimidazole |
| SMILES | COc1ccc2nc(-c3ccc(C)c(N4CCCCC4)c3)[nH]c2c1 |
| InChI | InChI=1S/C20H23N3O/c1-14-6-7-15(12-19(14)23-10-4-3-5-11-23)20-21-17-9-8-16(24-2)13-18(17)22-20/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,21,22) |
| InChIKey | WFJCHVWDNWPKNI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |