About 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol
3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol (PubChem CID 103597559) has the molecular formula C18H18N2O3S2
and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol |
| PubChem CID | 103597559 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol |
| SMILES | CCSc1cc(-c2nc(-c3ccc(OC)c(O)c3OC)cs2)ccn1 |
| InChI | InChI=1S/C18H18N2O3S2/c1-4-24-15-9-11(7-8-19-15)18-20-13(10-25-18)12-5-6-14(22-2)16(21)17(12)23-3/h5-10,21H,4H2,1-3H3 |
| InChIKey | MLGNESILZMIKOA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol?
The IUPAC name of 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol (CID 103597559) is 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol.
What is the SMILES notation for 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol?
The canonical SMILES for 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol is CCSc1cc(-c2nc(-c3ccc(OC)c(O)c3OC)cs2)ccn1.
What is the InChIKey of 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol?
The InChIKey is MLGNESILZMIKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O3S2/c1-4-24-15-9-11(7-8-19-15)18-20-13(10-25-18)12-5-6-14(22-2)16(21)17(12)23-3/h5-10,21H,4H2,1-3H3.
What are the key properties of 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol?
3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol has a molecular weight of 374.49 g/mol, XLogP of 4.71, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-ethylsulfanyl-4-pyridinyl)-1,3-thiazol-4-yl]-2,6-dimethoxyphenol is sourced from PubChem (CID 103597559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).