About 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one
5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one (PubChem CID 10359768) has the molecular formula C17H14N4O2S
and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one.
Molecular Properties
| Compound Name | 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one |
| PubChem CID | 10359768 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one |
| SMILES | COc1cccc2c1CN(c1csc(-c3ccncc3)n1)C(=O)N2 |
| InChI | InChI=1S/C17H14N4O2S/c1-23-14-4-2-3-13-12(14)9-21(17(22)19-13)15-10-24-16(20-15)11-5-7-18-8-6-11/h2-8,10H,9H2,1H3,(H,19,22) |
| InChIKey | ZSAQGXDSTQPMRV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one?
The IUPAC name of 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one (CID 10359768) is 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one.
What is the SMILES notation for 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one?
The canonical SMILES for 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one is COc1cccc2c1CN(c1csc(-c3ccncc3)n1)C(=O)N2.
What is the InChIKey of 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one?
The InChIKey is ZSAQGXDSTQPMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O2S/c1-23-14-4-2-3-13-12(14)9-21(17(22)19-13)15-10-24-16(20-15)11-5-7-18-8-6-11/h2-8,10H,9H2,1H3,(H,19,22).
What are the key properties of 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one?
5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one has a molecular weight of 338.39 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3-(2-pyridin-4-yl-1,3-thiazol-4-yl)-1,4-dihydroquinazolin-2-one is sourced from PubChem (CID 10359768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).