C17H19F3N2O4 — CID 103598129
methyl 4-[3-[[2-(dimethylamino)-2-oxoethyl]-(2,2,2-trifluoroethyl)amino]-3-oxoprop-1-enyl]benzoate (PubChem CID 103598129) has the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is methyl 4-[3-[[2-(dimethylamino)-2-oxoethyl]-(2,2,2-trifluoroethyl)amino]-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[3-[[2-(dimethylamino)-2-oxoethyl]-(2,2,2-trifluoroethyl)amino]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 103598129 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | methyl 4-[3-[[2-(dimethylamino)-2-oxoethyl]-(2,2,2-trifluoroethyl)amino]-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=CC(=O)N(CC(=O)N(C)C)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N2O4/c1-21(2)15(24)10-22(11-17(18,19)20)14(23)9-6-12-4-7-13(8-5-12)16(25)26-3/h4-9H,10-11H2,1-3H3 |
| InChIKey | PASYCOKOMFZIOA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|