C16H14N4OS — CID 103598498
N-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 103598498) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 103598498 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | Cc1ncc(CNC(=O)C=Cc2cnc3ccccc3n2)s1 |
| InChI | InChI=1S/C16H14N4OS/c1-11-17-9-13(22-11)10-19-16(21)7-6-12-8-18-14-4-2-3-5-15(14)20-12/h2-9H,10H2,1H3,(H,19,21) |
| InChIKey | OGNKQALDIDQPML-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|