C21H19N3O — CID 103598885
3-(3-phenylphenyl)-1-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one (PubChem CID 103598885) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(3-phenylphenyl)-1-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one.
| Compound Name | 3-(3-phenylphenyl)-1-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 103598885 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-(3-phenylphenyl)-1-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(-c2ccccc2)c1)N1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C21H19N3O/c25-21(24-12-11-20-19(15-24)14-22-23-20)10-9-16-5-4-8-18(13-16)17-6-2-1-3-7-17/h1-10,13-14H,11-12,15H2,(H,22,23) |
| InChIKey | GMWHTUHSDGVOHL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|