C13H23ClN2O — CID 103599164
1-(3-chloroprop-2-enyl)-N,N-diethylpiperidine-4-carboxamide (PubChem CID 103599164) has the molecular formula C13H23ClN2O and a molecular weight of 258.79 g/mol. Its IUPAC name is 1-(3-chloroprop-2-enyl)-N,N-diethylpiperidine-4-carboxamide.
| Compound Name | 1-(3-chloroprop-2-enyl)-N,N-diethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 103599164 |
| Molecular Formula | C13H23ClN2O |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-(3-chloroprop-2-enyl)-N,N-diethylpiperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCN(CC=CCl)CC1 |
| InChI | InChI=1S/C13H23ClN2O/c1-3-16(4-2)13(17)12-6-10-15(11-7-12)9-5-8-14/h5,8,12H,3-4,6-7,9-11H2,1-2H3 |
| InChIKey | JGNDWNMUORJKMA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |