C17H22N2O2 — CID 103599854
3-benzyl-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 103599854) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-benzyl-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-benzyl-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 103599854 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3-benzyl-8-ethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCC1CCC2(CC1)NC(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C17H22N2O2/c1-2-13-8-10-17(11-9-13)15(20)19(16(21)18-17)12-14-6-4-3-5-7-14/h3-7,13H,2,8-12H2,1H3,(H,18,21) |
| InChIKey | SMZDLGAQCMPQCY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|