C17H26O5S — CID 10360028
(E,3R,4S,5S)-1-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethylhept-1-en-3-ol (PubChem CID 10360028) has the molecular formula C17H26O5S and a molecular weight of 342.46 g/mol. Its IUPAC name is (E,3R,4S,5S)-1-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethylhept-1-en-3-ol.
| Compound Name | (E,3R,4S,5S)-1-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethylhept-1-en-3-ol |
|---|---|
| PubChem CID | 10360028 |
| Molecular Formula | C17H26O5S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (E,3R,4S,5S)-1-(benzenesulfonyl)-5-(methoxymethoxy)-4,6-dimethylhept-1-en-3-ol |
| SMILES | COCO[C@@H](C(C)C)[C@@H](C)[C@@H](O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H26O5S/c1-13(2)17(22-12-21-4)14(3)16(18)10-11-23(19,20)15-8-6-5-7-9-15/h5-11,13-14,16-18H,12H2,1-4H3/b11-10+/t14-,16-,17-/m0/s1 |
| InChIKey | QWSZMBOLATZTQL-RACIWXJFSA-N |
| XLogP | 2.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|