About N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine
N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine (PubChem CID 10360043) has the molecular formula C20H46N4
and a molecular weight of 342.62 g/mol. Its IUPAC name is N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine.
Molecular Properties
| Compound Name | N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine |
| PubChem CID | 10360043 |
| Molecular Formula | C20H46N4 |
| Molecular Weight | 342.62 g/mol |
| Exact Mass | 342.37 |
| IUPAC Name | N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine |
| SMILES | CC(C)(C)NCCCCNCCCCNCCCCNC(C)(C)C |
| InChI | InChI=1S/C20H46N4/c1-19(2,3)23-17-11-9-15-21-13-7-8-14-22-16-10-12-18-24-20(4,5)6/h21-24H,7-18H2,1-6H3 |
| InChIKey | SMBPHPMWRZNIRT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine?
The IUPAC name of N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine (CID 10360043) is N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine.
What is the SMILES notation for N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine?
The canonical SMILES for N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine is CC(C)(C)NCCCCNCCCCNCCCCNC(C)(C)C.
What is the InChIKey of N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine?
The InChIKey is SMBPHPMWRZNIRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H46N4/c1-19(2,3)23-17-11-9-15-21-13-7-8-14-22-16-10-12-18-24-20(4,5)6/h21-24H,7-18H2,1-6H3.
What are the key properties of N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine?
N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine has a molecular weight of 342.62 g/mol, XLogP of 3.28, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis[4-(tert-butylamino)butyl]butane-1,4-diamine is sourced from PubChem (CID 10360043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).