About N-cyclohexyl-2,2-difluoroacetamide
N-cyclohexyl-2,2-difluoroacetamide (PubChem CID 103600496) has the molecular formula C8H13F2NO
and a molecular weight of 177.19 g/mol. Its IUPAC name is N-cyclohexyl-2,2-difluoroacetamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2,2-difluoroacetamide |
| PubChem CID | 103600496 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-cyclohexyl-2,2-difluoroacetamide |
| SMILES | O=C(NC1CCCCC1)C(F)F |
| InChI | InChI=1S/C8H13F2NO/c9-7(10)8(12)11-6-4-2-1-3-5-6/h6-7H,1-5H2,(H,11,12) |
| InChIKey | JOGQHMVHCHFMLE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexyl-2,2-difluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2,2-difluoroacetamide?
The IUPAC name of N-cyclohexyl-2,2-difluoroacetamide (CID 103600496) is N-cyclohexyl-2,2-difluoroacetamide.
What is the SMILES notation for N-cyclohexyl-2,2-difluoroacetamide?
The canonical SMILES for N-cyclohexyl-2,2-difluoroacetamide is O=C(NC1CCCCC1)C(F)F.
What is the InChIKey of N-cyclohexyl-2,2-difluoroacetamide?
The InChIKey is JOGQHMVHCHFMLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO/c9-7(10)8(12)11-6-4-2-1-3-5-6/h6-7H,1-5H2,(H,11,12).
What are the key properties of N-cyclohexyl-2,2-difluoroacetamide?
N-cyclohexyl-2,2-difluoroacetamide has a molecular weight of 177.19 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2,2-difluoroacetamide is sourced from PubChem (CID 103600496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).